C27H25F9N2O4S2 — CID 139365452
[(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1-imino-1-oxothian-4-yl)methanone (PubChem CID 139365452) has the molecular formula C27H25F9N2O4S2 and a molecular weight of 676.62 g/mol. Its IUPAC name is [(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1-imino-1-oxothian-4-yl)methanone.
| Compound Name | [(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1-imino-1-oxothian-4-yl)methanone |
|---|---|
| PubChem CID | 139365452 |
| Molecular Formula | C27H25F9N2O4S2 |
| Molecular Weight | 676.62 g/mol |
| Exact Mass | 676.11 |
| IUPAC Name | [(3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-fluoro-1-imino-1-oxothian-4-yl)methanone |
| SMILES | [H]N=S1(=O)CCC(F)(C(=O)N2CC[C@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@H]23)CC1 |
| InChI | InChI=1S/C27H25F9N2O4S2/c28-18-3-5-19(6-4-18)44(41,42)24-9-12-38(22(39)23(29)10-13-43(37,40)14-11-23)21(24)8-1-16-15-17(2-7-20(16)24)25(30,26(31,32)33)27(34,35)36/h2-7,15,21,37H,1,8-14H2/t21-,23?,24-,43?/m0/s1 |
| InChIKey | ORVYDQFLAAFUJK-RSYISMLQSA-N |
| XLogP | 5.88 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |