C28H27F8NO4S — CID 122678619
[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone (PubChem CID 122678619) has the molecular formula C28H27F8NO4S and a molecular weight of 625.58 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone.
| Compound Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone |
|---|---|
| PubChem CID | 122678619 |
| Molecular Formula | C28H27F8NO4S |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 625.15 |
| IUPAC Name | [(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone |
| SMILES | O=C(C1CCC(O)CC1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H27F8NO4S/c29-19-5-9-21(10-6-19)42(40,41)25-13-14-37(24(39)16-1-7-20(38)8-2-16)23(25)12-3-17-15-18(4-11-22(17)25)26(30,27(31,32)33)28(34,35)36/h4-6,9-11,15-16,20,23,38H,1-3,7-8,12-14H2/t16?,20?,23-,25-/m1/s1 |
| InChIKey | CZOAKRDFNBPBNH-LEWYKCKKSA-N |
| XLogP | 5.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |