C26H25F8NO4S — CID 122669223
tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate (PubChem CID 122669223) has the molecular formula C26H25F8NO4S and a molecular weight of 599.54 g/mol. Its IUPAC name is tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 122669223 |
| Molecular Formula | C26H25F8NO4S |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H25F8NO4S/c1-22(2,3)39-21(36)35-13-12-23(40(37,38)18-8-6-17(27)7-9-18)19-10-5-16(14-15(19)4-11-20(23)35)24(28,25(29,30)31)26(32,33)34/h5-10,14,20H,4,11-13H2,1-3H3/t20-,23-/m1/s1 |
| InChIKey | AMTMRPVWXUCWQH-NFBKMPQASA-N |
| XLogP | 6.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |