C26H23F8NO5S — CID 122669072
tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-oxo-1,3a,4,5-tetrahydrobenzo[e]indole-3-carboxylate (PubChem CID 122669072) has the molecular formula C26H23F8NO5S and a molecular weight of 613.52 g/mol. Its IUPAC name is tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-oxo-1,3a,4,5-tetrahydrobenzo[e]indole-3-carboxylate.
| Compound Name | tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-oxo-1,3a,4,5-tetrahydrobenzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 122669072 |
| Molecular Formula | C26H23F8NO5S |
| Molecular Weight | 613.52 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | tert-butyl (3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-oxo-1,3a,4,5-tetrahydrobenzo[e]indole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)C[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H23F8NO5S/c1-22(2,3)40-21(37)35-19-11-4-14-12-15(24(28,25(29,30)31)26(32,33)34)5-10-18(14)23(19,13-20(35)36)41(38,39)17-8-6-16(27)7-9-17/h5-10,12,19H,4,11,13H2,1-3H3/t19-,23-/m1/s1 |
| InChIKey | MRGWWFKFPPNJDP-AUSIDOKSSA-N |
| XLogP | 6.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |