C31H27F8NO5S2 — CID 122678670
1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3-(4-methylphenyl)sulfonylpropan-1-one (PubChem CID 122678670) has the molecular formula C31H27F8NO5S2 and a molecular weight of 709.68 g/mol. Its IUPAC name is 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3-(4-methylphenyl)sulfonylpropan-1-one.
| Compound Name | 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3-(4-methylphenyl)sulfonylpropan-1-one |
|---|---|
| PubChem CID | 122678670 |
| Molecular Formula | C31H27F8NO5S2 |
| Molecular Weight | 709.68 g/mol |
| Exact Mass | 709.12 |
| IUPAC Name | 1-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3-(4-methylphenyl)sulfonylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)cc1 |
| InChI | InChI=1S/C31H27F8NO5S2/c1-19-2-8-23(9-3-19)46(42,43)17-14-27(41)40-16-15-28(47(44,45)24-10-6-22(32)7-11-24)25-12-5-21(18-20(25)4-13-26(28)40)29(33,30(34,35)36)31(37,38)39/h2-3,5-12,18,26H,4,13-17H2,1H3/t26-,28-/m1/s1 |
| InChIKey | RPLMWNRMFNEEOY-IXCJQBJRSA-N |
| XLogP | 6.50 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |