C28H27F7INO4S — CID 122680703
[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone (PubChem CID 122680703) has the molecular formula C28H27F7INO4S and a molecular weight of 733.48 g/mol. Its IUPAC name is [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone.
| Compound Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone |
|---|---|
| PubChem CID | 122680703 |
| Molecular Formula | C28H27F7INO4S |
| Molecular Weight | 733.48 g/mol |
| Exact Mass | 733.06 |
| IUPAC Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxycyclohexyl)methanone |
| SMILES | O=C(C1CCC(O)CC1)N1CC[C@@]2(S(=O)(=O)c3ccc(I)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C28H27F7INO4S/c29-26(27(30,31)32,28(33,34)35)18-4-11-22-17(15-18)3-12-23-25(22,42(40,41)21-9-5-19(36)6-10-21)13-14-37(23)24(39)16-1-7-20(38)8-2-16/h4-6,9-11,15-16,20,23,38H,1-3,7-8,12-14H2/t16?,20?,23-,25-/m1/s1 |
| InChIKey | QLVGIAISWQMPRX-LEWYKCKKSA-N |
| XLogP | 6.35 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.48 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|