C29H27F7INO3S — CID 122680857
[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]methanone (PubChem CID 122680857) has the molecular formula C29H27F7INO3S and a molecular weight of 729.50 g/mol. Its IUPAC name is [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]methanone.
| Compound Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]methanone |
|---|---|
| PubChem CID | 122680857 |
| Molecular Formula | C29H27F7INO3S |
| Molecular Weight | 729.50 g/mol |
| Exact Mass | 729.06 |
| IUPAC Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,6S)-7-bicyclo[4.1.0]heptanyl]methanone |
| SMILES | O=C(C1[C@H]2CCCC[C@@H]12)N1CC[C@@]2(S(=O)(=O)c3ccc(I)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C29H27F7INO3S/c30-27(28(31,32)33,29(34,35)36)17-6-11-22-16(15-17)5-12-23-26(22,42(40,41)19-9-7-18(37)8-10-19)13-14-38(23)25(39)24-20-3-1-2-4-21(20)24/h6-11,15,20-21,23-24H,1-5,12-14H2/t20-,21+,23-,24?,26-/m1/s1 |
| InChIKey | MZZSTHRTEYFSRV-IVJFXMQNSA-N |
| XLogP | 7.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.50 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|