C25H19F7IN3O2S — CID 122680872
(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-pyrimidin-2-yl-2,3a,4,5-tetrahydro-1H-benzo[e]indole (PubChem CID 122680872) has the molecular formula C25H19F7IN3O2S and a molecular weight of 685.40 g/mol. Its IUPAC name is (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-pyrimidin-2-yl-2,3a,4,5-tetrahydro-1H-benzo[e]indole.
| Compound Name | (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-pyrimidin-2-yl-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
|---|---|
| PubChem CID | 122680872 |
| Molecular Formula | C25H19F7IN3O2S |
| Molecular Weight | 685.40 g/mol |
| Exact Mass | 685.01 |
| IUPAC Name | (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-pyrimidin-2-yl-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
| SMILES | O=S(=O)(c1ccc(I)cc1)[C@@]12CCN(c3ncccn3)[C@@H]1CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C25H19F7IN3O2S/c26-23(24(27,28)29,25(30,31)32)16-3-8-19-15(14-16)2-9-20-22(19,10-13-36(20)21-34-11-1-12-35-21)39(37,38)18-6-4-17(33)5-7-18/h1,3-8,11-12,14,20H,2,9-10,13H2/t20-,22-/m1/s1 |
| InChIKey | AUDSATDHKUHPAI-IFMALSPDSA-N |
| XLogP | 6.26 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.40 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|