C29H22ClF7INO4S — CID 122680825
4-[[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methyl]-3-chlorobenzoic acid (PubChem CID 122680825) has the molecular formula C29H22ClF7INO4S and a molecular weight of 775.91 g/mol. Its IUPAC name is 4-[[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methyl]-3-chlorobenzoic acid.
| Compound Name | 4-[[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methyl]-3-chlorobenzoic acid |
|---|---|
| PubChem CID | 122680825 |
| Molecular Formula | C29H22ClF7INO4S |
| Molecular Weight | 775.91 g/mol |
| Exact Mass | 774.99 |
| IUPAC Name | 4-[[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methyl]-3-chlorobenzoic acid |
| SMILES | O=C(O)c1ccc(CN2CC[C@@]3(S(=O)(=O)c4ccc(I)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)c(Cl)c1 |
| InChI | InChI=1S/C29H22ClF7INO4S/c30-23-14-17(25(40)41)1-2-18(23)15-39-12-11-26(44(42,43)21-7-5-20(38)6-8-21)22-9-4-19(13-16(22)3-10-24(26)39)27(31,28(32,33)34)29(35,36)37/h1-2,4-9,13-14,24H,3,10-12,15H2,(H,40,41)/t24-,26-/m1/s1 |
| InChIKey | OXNMTKRGIFVKCM-AOYPEHQESA-N |
| XLogP | 7.82 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.91 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|