C27H21F7INO2S — CID 122680770
(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-phenyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole (PubChem CID 122680770) has the molecular formula C27H21F7INO2S and a molecular weight of 683.43 g/mol. Its IUPAC name is (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-phenyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole.
| Compound Name | (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-phenyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
|---|---|
| PubChem CID | 122680770 |
| Molecular Formula | C27H21F7INO2S |
| Molecular Weight | 683.43 g/mol |
| Exact Mass | 683.02 |
| IUPAC Name | (3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-3-phenyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole |
| SMILES | O=S(=O)(c1ccc(I)cc1)[C@@]12CCN(c3ccccc3)[C@@H]1CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C27H21F7INO2S/c28-25(26(29,30)31,27(32,33)34)18-7-12-22-17(16-18)6-13-23-24(22,14-15-36(23)20-4-2-1-3-5-20)39(37,38)21-10-8-19(35)9-11-21/h1-5,7-12,16,23H,6,13-15H2/t23-,24-/m1/s1 |
| InChIKey | VOLMUCSHIVJXSN-DNQXCXABSA-N |
| XLogP | 7.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.43 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|