C26H21F8I2NO3S — CID 122680854
[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluoro-3-iodocyclobutyl)methanone (PubChem CID 122680854) has the molecular formula C26H21F8I2NO3S and a molecular weight of 833.32 g/mol. Its IUPAC name is [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluoro-3-iodocyclobutyl)methanone.
| Compound Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluoro-3-iodocyclobutyl)methanone |
|---|---|
| PubChem CID | 122680854 |
| Molecular Formula | C26H21F8I2NO3S |
| Molecular Weight | 833.32 g/mol |
| Exact Mass | 832.92 |
| IUPAC Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(3-fluoro-3-iodocyclobutyl)methanone |
| SMILES | O=C(C1CC(F)(I)C1)N1CC[C@@]2(S(=O)(=O)c3ccc(I)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H21F8I2NO3S/c27-22(36)12-15(13-22)21(38)37-10-9-23(41(39,40)18-5-3-17(35)4-6-18)19-7-2-16(11-14(19)1-8-20(23)37)24(28,25(29,30)31)26(32,33)34/h2-7,11,15,20H,1,8-10,12-13H2/t15?,20-,22?,23-/m1/s1 |
| InChIKey | XTZLDUBABMKWBN-POVVUFBQSA-N |
| XLogP | 7.31 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.32 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|