C30H31ClF7NO3S — CID 145184214
[9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-ethylcyclohexyl)methanone (PubChem CID 145184214) has the molecular formula C30H31ClF7NO3S and a molecular weight of 654.09 g/mol. Its IUPAC name is [9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-ethylcyclohexyl)methanone.
| Compound Name | [9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-ethylcyclohexyl)methanone |
|---|---|
| PubChem CID | 145184214 |
| Molecular Formula | C30H31ClF7NO3S |
| Molecular Weight | 654.09 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | [9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-ethylcyclohexyl)methanone |
| SMILES | CCC1CCC(C(=O)N2CCC3(S(=O)(=O)c4ccc(Cl)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CCC23)CC1 |
| InChI | InChI=1S/C30H31ClF7NO3S/c1-2-18-3-5-19(6-4-18)26(40)39-16-15-27(43(41,42)23-11-9-22(31)10-12-23)24-13-8-21(17-20(24)7-14-25(27)39)28(32,29(33,34)35)30(36,37)38/h8-13,17-19,25H,2-7,14-16H2,1H3 |
| InChIKey | VJONFMQRGQOBBZ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.09 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |