C30H29ClF7NO5S — CID 122678587
4-[9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 122678587) has the molecular formula C30H29ClF7NO5S and a molecular weight of 684.07 g/mol. Its IUPAC name is 4-[9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122678587 |
| Molecular Formula | C30H29ClF7NO5S |
| Molecular Weight | 684.07 g/mol |
| Exact Mass | 683.13 |
| IUPAC Name | 4-[9b-(3-chloro-4-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)C23CCN(C(=O)C4CCC(C(=O)O)CC4)C2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)cc1Cl |
| InChI | InChI=1S/C30H29ClF7NO5S/c1-16-2-9-21(15-23(16)31)45(43,44)27-12-13-39(25(40)17-3-5-18(6-4-17)26(41)42)24(27)11-7-19-14-20(8-10-22(19)27)28(32,29(33,34)35)30(36,37)38/h2,8-10,14-15,17-18,24H,3-7,11-13H2,1H3,(H,41,42) |
| InChIKey | DRMBQFRPYKUROH-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.07 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |