C33H36F7NO4S — CID 162597503
[9b-(3,4-dimethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(7-hydroxyspiro[3.5]nonan-2-yl)methanone (PubChem CID 162597503) has the molecular formula C33H36F7NO4S and a molecular weight of 675.71 g/mol. Its IUPAC name is [9b-(3,4-dimethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(7-hydroxyspiro[3.5]nonan-2-yl)methanone.
| Compound Name | [9b-(3,4-dimethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(7-hydroxyspiro[3.5]nonan-2-yl)methanone |
|---|---|
| PubChem CID | 162597503 |
| Molecular Formula | C33H36F7NO4S |
| Molecular Weight | 675.71 g/mol |
| Exact Mass | 675.23 |
| IUPAC Name | [9b-(3,4-dimethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(7-hydroxyspiro[3.5]nonan-2-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)C23CCN(C(=O)C4CC5(CCC(O)CC5)C4)C2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)cc1C |
| InChI | InChI=1S/C33H36F7NO4S/c1-19-3-6-25(15-20(19)2)46(44,45)30-13-14-41(28(43)22-17-29(18-22)11-9-24(42)10-12-29)27(30)8-4-21-16-23(5-7-26(21)30)31(34,32(35,36)37)33(38,39)40/h3,5-7,15-16,22,24,27,42H,4,8-14,17-18H2,1-2H3 |
| InChIKey | FHIUVNWCVYAOBT-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.71 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |