C29H30F7NO3S — CID 145184112
cyclohexyl-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methanone (PubChem CID 145184112) has the molecular formula C29H30F7NO3S and a molecular weight of 605.62 g/mol. Its IUPAC name is cyclohexyl-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methanone.
| Compound Name | cyclohexyl-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methanone |
|---|---|
| PubChem CID | 145184112 |
| Molecular Formula | C29H30F7NO3S |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | cyclohexyl-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(3-methylphenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]methanone |
| SMILES | Cc1cccc(S(=O)(=O)C23CCN(C(=O)C4CCCCC4)C2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)c1 |
| InChI | InChI=1S/C29H30F7NO3S/c1-18-6-5-9-22(16-18)41(39,40)26-14-15-37(25(38)19-7-3-2-4-8-19)24(26)13-10-20-17-21(11-12-23(20)26)27(30,28(31,32)33)29(34,35)36/h5-6,9,11-12,16-17,19,24H,2-4,7-8,10,13-15H2,1H3 |
| InChIKey | FKBKVNQHEGXZDR-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |