C28H28F8N2O3S — CID 145183881
[9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-cyclohexylmethanone (PubChem CID 145183881) has the molecular formula C28H28F8N2O3S and a molecular weight of 624.59 g/mol. Its IUPAC name is [9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-cyclohexylmethanone.
| Compound Name | [9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 145183881 |
| Molecular Formula | C28H28F8N2O3S |
| Molecular Weight | 624.59 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | [9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-cyclohexylmethanone |
| SMILES | CN1CC2N(C(=O)C3CCCCC3)CCC2(S(=O)(=O)c2cccc(F)c2)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C28H28F8N2O3S/c1-37-16-23-25(42(40,41)20-9-5-8-19(29)15-20,12-13-38(23)24(39)17-6-3-2-4-7-17)21-11-10-18(14-22(21)37)26(30,27(31,32)33)28(34,35)36/h5,8-11,14-15,17,23H,2-4,6-7,12-13,16H2,1H3 |
| InChIKey | JTJRNXVHRUGQDM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |