C27H26F8N2O3S — CID 145184224
[9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(4-fluorocyclohexyl)methanone (PubChem CID 145184224) has the molecular formula C27H26F8N2O3S and a molecular weight of 610.57 g/mol. Its IUPAC name is [9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(4-fluorocyclohexyl)methanone.
| Compound Name | [9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(4-fluorocyclohexyl)methanone |
|---|---|
| PubChem CID | 145184224 |
| Molecular Formula | C27H26F8N2O3S |
| Molecular Weight | 610.57 g/mol |
| Exact Mass | 610.15 |
| IUPAC Name | [9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(4-fluorocyclohexyl)methanone |
| SMILES | O=C(C1CCC(F)CC1)N1CCC2(S(=O)(=O)c3ccccc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3NCC12 |
| InChI | InChI=1S/C27H26F8N2O3S/c28-18-9-6-16(7-10-18)23(38)37-13-12-24(41(39,40)19-4-2-1-3-5-19)20-11-8-17(14-21(20)36-15-22(24)37)25(29,26(30,31)32)27(33,34)35/h1-5,8,11,14,16,18,22,36H,6-7,9-10,12-13,15H2 |
| InChIKey | DNJWLHHYMGDNDJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |