C28H27F9N2O5S — CID 145184164
[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(1-fluorocyclohexyl)methanone;formic acid (PubChem CID 145184164) has the molecular formula C28H27F9N2O5S and a molecular weight of 674.58 g/mol. Its IUPAC name is [9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(1-fluorocyclohexyl)methanone;formic acid.
| Compound Name | [9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(1-fluorocyclohexyl)methanone;formic acid |
|---|---|
| PubChem CID | 145184164 |
| Molecular Formula | C28H27F9N2O5S |
| Molecular Weight | 674.58 g/mol |
| Exact Mass | 674.15 |
| IUPAC Name | [9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-pyrrolo[2,3-c]quinolin-3-yl]-(1-fluorocyclohexyl)methanone;formic acid |
| SMILES | O=C(N1CCC2(S(=O)(=O)c3ccc(F)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3NCC12)C1(F)CCCCC1.O=CO |
| InChI | InChI=1S/C27H25F9N2O3S.CH2O2/c28-17-5-7-18(8-6-17)42(40,41)24-12-13-38(22(39)23(29)10-2-1-3-11-23)21(24)15-37-20-14-16(4-9-19(20)24)25(30,26(31,32)33)27(34,35)36;2-1-3/h4-9,14,21,37H,1-3,10-13,15H2;1H,(H,2,3) |
| InChIKey | JKQWYEOSJPEYAF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|