C28H19F8NO6S — CID 122678808
4-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid (PubChem CID 122678808) has the molecular formula C28H19F8NO6S and a molecular weight of 649.51 g/mol. Its IUPAC name is 4-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid.
| Compound Name | 4-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 122678808 |
| Molecular Formula | C28H19F8NO6S |
| Molecular Weight | 649.51 g/mol |
| Exact Mass | 649.08 |
| IUPAC Name | 4-[9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CCC3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4OCC23)cc1 |
| InChI | InChI=1S/C28H19F8NO6S/c29-18-6-8-19(9-7-18)44(41,42)25-11-12-37(23(38)15-1-3-16(4-2-15)24(39)40)22(25)14-43-21-13-17(5-10-20(21)25)26(30,27(31,32)33)28(34,35)36/h1-10,13,22H,11-12,14H2,(H,39,40) |
| InChIKey | ILAQGJPMXAMLFT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |