C32H34F7NO6S — CID 139387090
4-[1-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]cyclohexyl]butanoic acid (PubChem CID 139387090) has the molecular formula C32H34F7NO6S and a molecular weight of 693.68 g/mol. Its IUPAC name is 4-[1-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]cyclohexyl]butanoic acid.
| Compound Name | 4-[1-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]cyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 139387090 |
| Molecular Formula | C32H34F7NO6S |
| Molecular Weight | 693.68 g/mol |
| Exact Mass | 693.20 |
| IUPAC Name | 4-[1-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-methylphenyl)sulfonyl-1,2,3a,4-tetrahydrochromeno[3,4-b]pyrrole-3-carbonyl]cyclohexyl]butanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)C23CCN(C(=O)C4(CCCC(=O)O)CCCCC4)C2COc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C32H34F7NO6S/c1-20-7-10-22(11-8-20)47(44,45)29-16-17-40(27(43)28(13-3-2-4-14-28)15-5-6-26(41)42)25(29)19-46-24-18-21(9-12-23(24)29)30(33,31(34,35)36)32(37,38)39/h7-12,18,25H,2-6,13-17,19H2,1H3,(H,41,42) |
| InChIKey | ZTCYBAKNWIQBHF-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |