C28H29F8N2O3PS — CID 145184172
(1-fluorocyclohexyl)-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-9b-(4-phosphanylphenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]methanone (PubChem CID 145184172) has the molecular formula C28H29F8N2O3PS and a molecular weight of 656.58 g/mol. Its IUPAC name is (1-fluorocyclohexyl)-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-9b-(4-phosphanylphenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]methanone.
| Compound Name | (1-fluorocyclohexyl)-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-9b-(4-phosphanylphenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]methanone |
|---|---|
| PubChem CID | 145184172 |
| Molecular Formula | C28H29F8N2O3PS |
| Molecular Weight | 656.58 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | (1-fluorocyclohexyl)-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-9b-(4-phosphanylphenyl)sulfonyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]methanone |
| SMILES | CN1CC2N(C(=O)C3(F)CCCCC3)CCC2(S(=O)(=O)c2ccc(P)cc2)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C28H29F8N2O3PS/c1-37-16-22-25(43(40,41)19-8-6-18(42)7-9-19,13-14-38(22)23(39)24(29)11-3-2-4-12-24)20-10-5-17(15-21(20)37)26(30,27(31,32)33)28(34,35)36/h5-10,15,22H,2-4,11-14,16,42H2,1H3 |
| InChIKey | HWXADCDFZSINPS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|