C27H26ClF7N2O5S2 — CID 122678820
[9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone (PubChem CID 122678820) has the molecular formula C27H26ClF7N2O5S2 and a molecular weight of 691.09 g/mol. Its IUPAC name is [9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone.
| Compound Name | [9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 122678820 |
| Molecular Formula | C27H26ClF7N2O5S2 |
| Molecular Weight | 691.09 g/mol |
| Exact Mass | 690.09 |
| IUPAC Name | [9b-(4-chlorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinolin-3-yl]-(1,1-dioxothian-4-yl)methanone |
| SMILES | CN1CC2N(C(=O)C3CCS(=O)(=O)CC3)CCC2(S(=O)(=O)c2ccc(Cl)cc2)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C27H26ClF7N2O5S2/c1-36-15-22-24(44(41,42)19-5-3-18(28)4-6-19,10-11-37(22)23(38)16-8-12-43(39,40)13-9-16)20-7-2-17(14-21(20)36)25(29,26(30,31)32)27(33,34)35/h2-7,14,16,22H,8-13,15H2,1H3 |
| InChIKey | KXBOUMSMUPGJDE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.09 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |