C26H24F8N3O4PS — CID 145183814
5-[9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]-3-phosphanylpyrrolidin-2-one (PubChem CID 145183814) has the molecular formula C26H24F8N3O4PS and a molecular weight of 657.52 g/mol. Its IUPAC name is 5-[9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]-3-phosphanylpyrrolidin-2-one.
| Compound Name | 5-[9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]-3-phosphanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 145183814 |
| Molecular Formula | C26H24F8N3O4PS |
| Molecular Weight | 657.52 g/mol |
| Exact Mass | 657.11 |
| IUPAC Name | 5-[9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-5-methyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]-3-phosphanylpyrrolidin-2-one |
| SMILES | CN1CC2N(C(=O)C3CC(P)C(=O)N3)CCC2(S(=O)(=O)c2cccc(F)c2)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C26H24F8N3O4PS/c1-36-12-20-23(43(40,41)15-4-2-3-14(27)10-15,7-8-37(20)22(39)17-11-19(42)21(38)35-17)16-6-5-13(9-18(16)36)24(28,25(29,30)31)26(32,33)34/h2-6,9-10,17,19-20H,7-8,11-12,42H2,1H3,(H,35,38) |
| InChIKey | AWIRGBSZVMPMOD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|