C29H29F8NO4S — CID 122669087
[9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,2S)-4-hydroxy-2-methylcyclohexyl]methanone (PubChem CID 122669087) has the molecular formula C29H29F8NO4S and a molecular weight of 639.61 g/mol. Its IUPAC name is [9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,2S)-4-hydroxy-2-methylcyclohexyl]methanone.
| Compound Name | [9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,2S)-4-hydroxy-2-methylcyclohexyl]methanone |
|---|---|
| PubChem CID | 122669087 |
| Molecular Formula | C29H29F8NO4S |
| Molecular Weight | 639.61 g/mol |
| Exact Mass | 639.17 |
| IUPAC Name | [9b-(3-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[(1R,2S)-4-hydroxy-2-methylcyclohexyl]methanone |
| SMILES | C[C@H]1CC(O)CC[C@H]1C(=O)N1CCC2(S(=O)(=O)c3cccc(F)c3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CCC12 |
| InChI | InChI=1S/C29H29F8NO4S/c1-16-13-20(39)7-8-22(16)25(40)38-12-11-26(43(41,42)21-4-2-3-19(30)15-21)23-9-6-18(14-17(23)5-10-24(26)38)27(31,28(32,33)34)29(35,36)37/h2-4,6,9,14-16,20,22,24,39H,5,7-8,10-13H2,1H3/t16-,20?,22+,24?,26?/m0/s1 |
| InChIKey | FFZHKKVFUNSGEG-QXUMJZPISA-N |
| XLogP | 6.13 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |