C24H25F4NO3S — CID 122675974
1-[7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2,2,2-trifluoroethanone (PubChem CID 122675974) has the molecular formula C24H25F4NO3S and a molecular weight of 483.53 g/mol. Its IUPAC name is 1-[7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 122675974 |
| Molecular Formula | C24H25F4NO3S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 1-[7-tert-butyl-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2,2,2-trifluoroethanone |
| SMILES | CC(C)(C)c1ccc2c(c1)CCC1N(C(=O)C(F)(F)F)CCC21S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C24H25F4NO3S/c1-22(2,3)16-8-9-19-15(13-16)7-10-20-23(19,11-12-29(20)21(30)24(26,27)28)33(31,32)18-6-4-5-17(25)14-18/h4-6,8-9,13-14,20H,7,10-12H2,1-3H3 |
| InChIKey | XLEPGPBUDUHJEF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |