C24H17F10I2NO4S — CID 122680795
(2S)-1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3,3,3-trifluoro-2-hydroxy-2-iodopropan-1-one (PubChem CID 122680795) has the molecular formula C24H17F10I2NO4S and a molecular weight of 859.26 g/mol. Its IUPAC name is (2S)-1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3,3,3-trifluoro-2-hydroxy-2-iodopropan-1-one.
| Compound Name | (2S)-1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3,3,3-trifluoro-2-hydroxy-2-iodopropan-1-one |
|---|---|
| PubChem CID | 122680795 |
| Molecular Formula | C24H17F10I2NO4S |
| Molecular Weight | 859.26 g/mol |
| Exact Mass | 858.88 |
| IUPAC Name | (2S)-1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-3,3,3-trifluoro-2-hydroxy-2-iodopropan-1-one |
| SMILES | O=C(N1CC[C@@]2(S(=O)(=O)c3ccc(I)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12)[C@](O)(I)C(F)(F)F |
| InChI | InChI=1S/C24H17F10I2NO4S/c25-20(22(26,27)28,23(29,30)31)13-2-7-16-12(11-13)1-8-17-19(16,42(40,41)15-5-3-14(35)4-6-15)9-10-37(17)18(38)21(36,39)24(32,33)34/h2-7,11,17,39H,1,8-10H2/t17-,19-,21-/m1/s1 |
| InChIKey | XTFOFBVDTUDAAI-YFVAEKQCSA-N |
| XLogP | 6.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.26 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|