C24H22F7IN2O3S — CID 122680822
3-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]propanamide (PubChem CID 122680822) has the molecular formula C24H22F7IN2O3S and a molecular weight of 678.41 g/mol. Its IUPAC name is 3-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]propanamide.
| Compound Name | 3-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]propanamide |
|---|---|
| PubChem CID | 122680822 |
| Molecular Formula | C24H22F7IN2O3S |
| Molecular Weight | 678.41 g/mol |
| Exact Mass | 678.03 |
| IUPAC Name | 3-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]propanamide |
| SMILES | NC(=O)CCN1CC[C@@]2(S(=O)(=O)c3ccc(I)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C24H22F7IN2O3S/c25-22(23(26,27)28,24(29,30)31)15-2-7-18-14(13-15)1-8-19-21(18,10-12-34(19)11-9-20(33)35)38(36,37)17-5-3-16(32)4-6-17/h2-7,13,19H,1,8-12H2,(H2,33,35)/t19-,21-/m1/s1 |
| InChIKey | IHYMZIVNWSHVRY-TZIWHRDSSA-N |
| XLogP | 5.15 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.41 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|