C26H23F7INO3S — CID 122680727
[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclobutylmethanone (PubChem CID 122680727) has the molecular formula C26H23F7INO3S and a molecular weight of 689.43 g/mol. Its IUPAC name is [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclobutylmethanone.
| Compound Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 122680727 |
| Molecular Formula | C26H23F7INO3S |
| Molecular Weight | 689.43 g/mol |
| Exact Mass | 689.03 |
| IUPAC Name | [(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-cyclobutylmethanone |
| SMILES | O=C(C1CCC1)N1CC[C@@]2(S(=O)(=O)c3ccc(I)cc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@@H]12 |
| InChI | InChI=1S/C26H23F7INO3S/c27-24(25(28,29)30,26(31,32)33)17-5-10-20-16(14-17)4-11-21-23(20,12-13-35(21)22(36)15-2-1-3-15)39(37,38)19-8-6-18(34)7-9-19/h5-10,14-15,21H,1-4,11-13H2/t21-,23-/m1/s1 |
| InChIKey | VUNYQVDRWURIHD-FYYLOGMGSA-N |
| XLogP | 6.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.43 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|