C28H26F7IN2O4S — CID 122680723
1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1-acetylazetidin-3-yl)ethanone (PubChem CID 122680723) has the molecular formula C28H26F7IN2O4S and a molecular weight of 746.48 g/mol. Its IUPAC name is 1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1-acetylazetidin-3-yl)ethanone.
| Compound Name | 1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1-acetylazetidin-3-yl)ethanone |
|---|---|
| PubChem CID | 122680723 |
| Molecular Formula | C28H26F7IN2O4S |
| Molecular Weight | 746.48 g/mol |
| Exact Mass | 746.05 |
| IUPAC Name | 1-[(3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-iodophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1-acetylazetidin-3-yl)ethanone |
| SMILES | CC(=O)N1CC(CC(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(I)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)C1 |
| InChI | InChI=1S/C28H26F7IN2O4S/c1-16(39)37-14-17(15-37)12-24(40)38-11-10-25(43(41,42)21-6-4-20(36)5-7-21)22-8-3-19(13-18(22)2-9-23(25)38)26(29,27(30,31)32)28(33,34)35/h3-8,13,17,23H,2,9-12,14-15H2,1H3/t23-,25-/m1/s1 |
| InChIKey | PWYWERAZYIBKEM-ILBGXUMGSA-N |
| XLogP | 5.67 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|