C22H22ClFINO4S — CID 122680613
2-iodopropan-2-yl 7-chloro-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate (PubChem CID 122680613) has the molecular formula C22H22ClFINO4S and a molecular weight of 577.84 g/mol. Its IUPAC name is 2-iodopropan-2-yl 7-chloro-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate.
| Compound Name | 2-iodopropan-2-yl 7-chloro-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate |
|---|---|
| PubChem CID | 122680613 |
| Molecular Formula | C22H22ClFINO4S |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.00 |
| IUPAC Name | 2-iodopropan-2-yl 7-chloro-9b-(3-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carboxylate |
| SMILES | CC(C)(I)OC(=O)N1CCC2(S(=O)(=O)c3cccc(F)c3)c3ccc(Cl)cc3CCC12 |
| InChI | InChI=1S/C22H22ClFINO4S/c1-21(2,25)30-20(27)26-11-10-22(31(28,29)17-5-3-4-16(24)13-17)18-8-7-15(23)12-14(18)6-9-19(22)26/h3-5,7-8,12-13,19H,6,9-11H2,1-2H3 |
| InChIKey | KVSUERQYSGLWIL-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|