C33H36F7N2O5PS — CID 145183982
4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-phosphanylphenyl)sulfonyl-5-propyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 145183982) has the molecular formula C33H36F7N2O5PS and a molecular weight of 736.69 g/mol. Its IUPAC name is 4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-phosphanylphenyl)sulfonyl-5-propyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-phosphanylphenyl)sulfonyl-5-propyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 145183982 |
| Molecular Formula | C33H36F7N2O5PS |
| Molecular Weight | 736.69 g/mol |
| Exact Mass | 736.20 |
| IUPAC Name | 4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-(4-phosphanylphenyl)sulfonyl-5-propyl-1,2,3a,4-tetrahydropyrrolo[2,3-c]quinoline-3-carbonyl]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | CCCN1CC2N(C(=O)C34CCC(C(=O)O)(CC3)CC4)CCC2(S(=O)(=O)c2ccc(P)cc2)c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C33H36F7N2O5PS/c1-2-16-41-19-25-30(49(46,47)22-6-4-21(48)5-7-22,23-8-3-20(18-24(23)41)31(34,32(35,36)37)33(38,39)40)15-17-42(25)26(43)28-9-12-29(13-10-28,14-11-28)27(44)45/h3-8,18,25H,2,9-17,19,48H2,1H3,(H,44,45) |
| InChIKey | WLGJYDSEZCGYKV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|