C31H26F7NO5S — CID 122678929
4-[9b-(4-ethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid (PubChem CID 122678929) has the molecular formula C31H26F7NO5S and a molecular weight of 657.60 g/mol. Its IUPAC name is 4-[9b-(4-ethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid.
| Compound Name | 4-[9b-(4-ethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 122678929 |
| Molecular Formula | C31H26F7NO5S |
| Molecular Weight | 657.60 g/mol |
| Exact Mass | 657.14 |
| IUPAC Name | 4-[9b-(4-ethylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]benzoic acid |
| SMILES | CCc1ccc(S(=O)(=O)C23CCN(C(=O)c4ccc(C(=O)O)cc4)C2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C31H26F7NO5S/c1-2-18-3-11-23(12-4-18)45(43,44)28-15-16-39(26(40)19-5-7-20(8-6-19)27(41)42)25(28)14-9-21-17-22(10-13-24(21)28)29(32,30(33,34)35)31(36,37)38/h3-8,10-13,17,25H,2,9,14-16H2,1H3,(H,41,42) |
| InChIKey | QQPSJEBSULQWPI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.60 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |