C33H30F7NO6S — CID 149347825
4-[9b-[4-(furan-3-yl)phenyl]sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 149347825) has the molecular formula C33H30F7NO6S and a molecular weight of 701.66 g/mol. Its IUPAC name is 4-[9b-[4-(furan-3-yl)phenyl]sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[9b-[4-(furan-3-yl)phenyl]sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 149347825 |
| Molecular Formula | C33H30F7NO6S |
| Molecular Weight | 701.66 g/mol |
| Exact Mass | 701.17 |
| IUPAC Name | 4-[9b-[4-(furan-3-yl)phenyl]sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CCC3(S(=O)(=O)c4ccc(-c5ccoc5)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CCC23)CC1 |
| InChI | InChI=1S/C33H30F7NO6S/c34-31(32(35,36)37,33(38,39)40)24-8-11-26-22(17-24)7-12-27-30(26,14-15-41(27)28(42)20-1-3-21(4-2-20)29(43)44)48(45,46)25-9-5-19(6-10-25)23-13-16-47-18-23/h5-6,8-11,13,16-18,20-21,27H,1-4,7,12,14-15H2,(H,43,44) |
| InChIKey | YFKLKVALJRYNJY-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.66 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |