C33H31F7N2O6S — CID 122678909
methyl 4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-[4-(1,2-oxazol-4-yl)phenyl]sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylate (PubChem CID 122678909) has the molecular formula C33H31F7N2O6S and a molecular weight of 716.67 g/mol. Its IUPAC name is methyl 4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-[4-(1,2-oxazol-4-yl)phenyl]sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-[4-(1,2-oxazol-4-yl)phenyl]sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 122678909 |
| Molecular Formula | C33H31F7N2O6S |
| Molecular Weight | 716.67 g/mol |
| Exact Mass | 716.18 |
| IUPAC Name | methyl 4-[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-9b-[4-(1,2-oxazol-4-yl)phenyl]sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(C(=O)N2CCC3(S(=O)(=O)c4ccc(-c5cnoc5)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CCC23)CC1 |
| InChI | InChI=1S/C33H31F7N2O6S/c1-47-29(44)21-4-2-20(3-5-21)28(43)42-15-14-30(49(45,46)25-10-6-19(7-11-25)23-17-41-48-18-23)26-12-9-24(16-22(26)8-13-27(30)42)31(34,32(35,36)37)33(38,39)40/h6-7,9-12,16-18,20-21,27H,2-5,8,13-15H2,1H3 |
| InChIKey | FPSHKNQWGIGWOU-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 106.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.67 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |