C27H24F9NO6S2 — CID 122679269
[9b-(3,4-difluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxy-1,1-dioxothian-4-yl)methanone (PubChem CID 122679269) has the molecular formula C27H24F9NO6S2 and a molecular weight of 693.61 g/mol. Its IUPAC name is [9b-(3,4-difluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxy-1,1-dioxothian-4-yl)methanone.
| Compound Name | [9b-(3,4-difluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxy-1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 122679269 |
| Molecular Formula | C27H24F9NO6S2 |
| Molecular Weight | 693.61 g/mol |
| Exact Mass | 693.09 |
| IUPAC Name | [9b-(3,4-difluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(4-hydroxy-1,1-dioxothian-4-yl)methanone |
| SMILES | O=C(N1CCC2(S(=O)(=O)c3ccc(F)c(F)c3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CCC12)C1(O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C27H24F9NO6S2/c28-19-5-3-17(14-20(19)29)45(42,43)24-7-10-37(22(38)23(39)8-11-44(40,41)12-9-23)21(24)6-1-15-13-16(2-4-18(15)24)25(30,26(31,32)33)27(34,35)36/h2-5,13-14,21,39H,1,6-12H2 |
| InChIKey | NDHMELMUEHGMOW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |