C30H31ClF7NO6S — CID 166668759
[9b-(4-chloro-3-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(dihydroxymethyl)-1-hydroxycyclohexyl]methanone (PubChem CID 166668759) has the molecular formula C30H31ClF7NO6S and a molecular weight of 702.09 g/mol. Its IUPAC name is [9b-(4-chloro-3-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(dihydroxymethyl)-1-hydroxycyclohexyl]methanone.
| Compound Name | [9b-(4-chloro-3-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(dihydroxymethyl)-1-hydroxycyclohexyl]methanone |
|---|---|
| PubChem CID | 166668759 |
| Molecular Formula | C30H31ClF7NO6S |
| Molecular Weight | 702.09 g/mol |
| Exact Mass | 701.14 |
| IUPAC Name | [9b-(4-chloro-3-methylphenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-[4-(dihydroxymethyl)-1-hydroxycyclohexyl]methanone |
| SMILES | Cc1cc(S(=O)(=O)C23CCN(C(=O)C4(O)CCC(C(O)O)CC4)C2CCc2cc(C(F)(C(F)(F)F)C(F)(F)F)ccc23)ccc1Cl |
| InChI | InChI=1S/C30H31ClF7NO6S/c1-16-14-20(4-6-22(16)31)46(44,45)27-12-13-39(25(42)26(43)10-8-17(9-11-26)24(40)41)23(27)7-2-18-15-19(3-5-21(18)27)28(32,29(33,34)35)30(36,37)38/h3-6,14-15,17,23-24,40-41,43H,2,7-13H2,1H3 |
| InChIKey | CDLZLBAENNNEFM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.09 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|