C32H34Cl2N2O4S — CID 155308482
[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 155308482) has the molecular formula C32H34Cl2N2O4S and a molecular weight of 613.61 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 155308482 |
| Molecular Formula | C32H34Cl2N2O4S |
| Molecular Weight | 613.61 g/mol |
| Exact Mass | 612.16 |
| IUPAC Name | [(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | CN1CCC(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccccc4)c4ccc(OCc5c(Cl)cccc5Cl)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C32H34Cl2N2O4S/c1-35-17-14-22(15-18-35)31(37)36-19-16-32(41(38,39)25-6-3-2-4-7-25)27-12-11-24(20-23(27)10-13-30(32)36)40-21-26-28(33)8-5-9-29(26)34/h2-9,11-12,20,22,30H,10,13-19,21H2,1H3/t30-,32-/m1/s1 |
| InChIKey | LLVAJHFTMKPBLT-XLJNKUFUSA-N |
| XLogP | 6.13 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.61 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |