C20H15N5 — CID 155309546
6-(2-ethynyl-4-pyridinyl)-7-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155309546) has the molecular formula C20H15N5 and a molecular weight of 325.38 g/mol. Its IUPAC name is 6-(2-ethynyl-4-pyridinyl)-7-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(2-ethynyl-4-pyridinyl)-7-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155309546 |
| Molecular Formula | C20H15N5 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 6-(2-ethynyl-4-pyridinyl)-7-methyl-5-phenylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C#Cc1cc(-c2c(-c3ccccc3)c3c(N)ncnc3n2C)ccn1 |
| InChI | InChI=1S/C20H15N5/c1-3-15-11-14(9-10-22-15)18-16(13-7-5-4-6-8-13)17-19(21)23-12-24-20(17)25(18)2/h1,4-12H,2H3,(H2,21,23,24) |
| InChIKey | SCHAXBNQUXGYME-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|