C19H20F2N2O4S — CID 155312017
4-[[4-(2-ethylbutanoylamino)phenyl]sulfinylamino]-2,5-difluorobenzoic acid (PubChem CID 155312017) has the molecular formula C19H20F2N2O4S and a molecular weight of 410.44 g/mol. Its IUPAC name is 4-[[4-(2-ethylbutanoylamino)phenyl]sulfinylamino]-2,5-difluorobenzoic acid.
| Compound Name | 4-[[4-(2-ethylbutanoylamino)phenyl]sulfinylamino]-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 155312017 |
| Molecular Formula | C19H20F2N2O4S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 4-[[4-(2-ethylbutanoylamino)phenyl]sulfinylamino]-2,5-difluorobenzoic acid |
| SMILES | CCC(CC)C(=O)Nc1ccc(S(=O)Nc2cc(F)c(C(=O)O)cc2F)cc1 |
| InChI | InChI=1S/C19H20F2N2O4S/c1-3-11(4-2)18(24)22-12-5-7-13(8-6-12)28(27)23-17-10-15(20)14(19(25)26)9-16(17)21/h5-11,23H,3-4H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | CHLRHZHZVVYRHS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |