C26H22FN3O2 — CID 155317912
4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenol (PubChem CID 155317912) has the molecular formula C26H22FN3O2 and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenol.
| Compound Name | 4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenol |
|---|---|
| PubChem CID | 155317912 |
| Molecular Formula | C26H22FN3O2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenol |
| SMILES | Oc1ccc(-c2c(C3CCOCC3)n(-c3ccc(F)cc3)c3cc4cn[nH]c4cc23)cc1 |
| InChI | InChI=1S/C26H22FN3O2/c27-19-3-5-20(6-4-19)30-24-13-18-15-28-29-23(18)14-22(24)25(16-1-7-21(31)8-2-16)26(30)17-9-11-32-12-10-17/h1-8,13-15,17,31H,9-12H2,(H,28,29) |
| InChIKey | GADRMUAXDIAONI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |