C10H15FO2 — CID 155320686
(2E)-4-fluoro-2-(hydroxymethylidene)-4-propan-2-ylcyclohexan-1-one (PubChem CID 155320686) has the molecular formula C10H15FO2 and a molecular weight of 186.23 g/mol. Its IUPAC name is (2E)-4-fluoro-2-(hydroxymethylidene)-4-propan-2-ylcyclohexan-1-one.
| Compound Name | (2E)-4-fluoro-2-(hydroxymethylidene)-4-propan-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 155320686 |
| Molecular Formula | C10H15FO2 |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (2E)-4-fluoro-2-(hydroxymethylidene)-4-propan-2-ylcyclohexan-1-one |
| SMILES | CC(C)C1(F)CCC(=O)/C(=C/O)C1 |
| InChI | InChI=1S/C10H15FO2/c1-7(2)10(11)4-3-9(13)8(5-10)6-12/h6-7,12H,3-5H2,1-2H3/b8-6+ |
| InChIKey | APXZMLIMSXQQFO-SOFGYWHQSA-N |
| XLogP | 2.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|