C22H29F5O2 — CID 173240647
(8R,9R,10S,13S,14S)-2-(hydroxymethylidene)-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 173240647) has the molecular formula C22H29F5O2 and a molecular weight of 420.46 g/mol. Its IUPAC name is (8R,9R,10S,13S,14S)-2-(hydroxymethylidene)-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10S,13S,14S)-2-(hydroxymethylidene)-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 173240647 |
| Molecular Formula | C22H29F5O2 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | (8R,9R,10S,13S,14S)-2-(hydroxymethylidene)-10,13-dimethyl-17-(1,1,2,2,2-pentafluoroethyl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CC(=CO)C(=O)CC1CC[C@@H]1[C@H]2CC[C@]2(C)C(C(F)(F)C(F)(F)F)CC[C@@H]12 |
| InChI | InChI=1S/C22H29F5O2/c1-19-8-7-16-14(15(19)5-6-18(19)21(23,24)22(25,26)27)4-3-13-9-17(29)12(11-28)10-20(13,16)2/h11,13-16,18,28H,3-10H2,1-2H3/t13?,14-,15-,16+,18?,19-,20-/m0/s1 |
| InChIKey | CJAJTKIQHMXQAR-XLEMMREQSA-N |
| XLogP | 6.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|