C21H28O5 — CID 98506199
(3Z,4aS,4bS,6aS,9Z,10aS,10bR,12aR)-3,9-bis(hydroxymethylidene)-10a,12a-dimethyl-4a,4b,5,6,6a,7,10,10b,11,12-decahydro-4H-naphtho[2,1-f]chromene-2,8-dione (PubChem CID 98506199) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is (3Z,4aS,4bS,6aS,9Z,10aS,10bR,12aR)-3,9-bis(hydroxymethylidene)-10a,12a-dimethyl-4a,4b,5,6,6a,7,10,10b,11,12-decahydro-4H-naphtho[2,1-f]chromene-2,8-dione.
| Compound Name | (3Z,4aS,4bS,6aS,9Z,10aS,10bR,12aR)-3,9-bis(hydroxymethylidene)-10a,12a-dimethyl-4a,4b,5,6,6a,7,10,10b,11,12-decahydro-4H-naphtho[2,1-f]chromene-2,8-dione |
|---|---|
| PubChem CID | 98506199 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (3Z,4aS,4bS,6aS,9Z,10aS,10bR,12aR)-3,9-bis(hydroxymethylidene)-10a,12a-dimethyl-4a,4b,5,6,6a,7,10,10b,11,12-decahydro-4H-naphtho[2,1-f]chromene-2,8-dione |
| SMILES | C[C@]12C/C(=C/O)C(=O)C[C@@H]1CC[C@H]1[C@H]2CC[C@@]2(C)OC(=O)/C(=C\O)C[C@@H]12 |
| InChI | InChI=1S/C21H28O5/c1-20-9-13(11-23)18(24)8-14(20)3-4-15-16(20)5-6-21(2)17(15)7-12(10-22)19(25)26-21/h10-11,14-17,22-23H,3-9H2,1-2H3/b12-10-,13-11-/t14-,15-,16+,17-,20-,21+/m0/s1 |
| InChIKey | GVQAFQYHTSGAPN-KKVHJLMDSA-N |
| XLogP | 4.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|