C25H24F12O2 — CID 154287060
(5S,8R,9S,10S,13S,14S)-2,16-bis(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 154287060) has the molecular formula C25H24F12O2 and a molecular weight of 584.44 g/mol. Its IUPAC name is (5S,8R,9S,10S,13S,14S)-2,16-bis(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (5S,8R,9S,10S,13S,14S)-2,16-bis(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 154287060 |
| Molecular Formula | C25H24F12O2 |
| Molecular Weight | 584.44 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | (5S,8R,9S,10S,13S,14S)-2,16-bis(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC(=C(C(F)(F)F)C(F)(F)F)C(=O)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)C(=O)C(=C(C(F)(F)F)C(F)(F)F)C[C@@H]12 |
| InChI | InChI=1S/C25H24F12O2/c1-20-6-5-14-11(15(20)8-12(19(20)39)17(22(26,27)28)23(29,30)31)4-3-10-7-16(38)13(9-21(10,14)2)18(24(32,33)34)25(35,36)37/h10-11,14-15H,3-9H2,1-2H3/t10-,11+,14-,15-,20-,21-/m0/s1 |
| InChIKey | KQVVSZVYCHDSGC-RJDZXMCRSA-N |
| XLogP | 8.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.44 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|