C19H39NO — CID 155322176
N-(2,4-diethyl-2,4-dimethylheptyl)-4-methylpentanamide (PubChem CID 155322176) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is N-(2,4-diethyl-2,4-dimethylheptyl)-4-methylpentanamide.
| Compound Name | N-(2,4-diethyl-2,4-dimethylheptyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 155322176 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | N-(2,4-diethyl-2,4-dimethylheptyl)-4-methylpentanamide |
| SMILES | CCCC(C)(CC)CC(C)(CC)CNC(=O)CCC(C)C |
| InChI | InChI=1S/C19H39NO/c1-8-13-18(6,9-2)14-19(7,10-3)15-20-17(21)12-11-16(4)5/h16H,8-15H2,1-7H3,(H,20,21) |
| InChIKey | XFBUEAJSJNWWNS-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |