C9H13F4NO — CID 155323199
4-[(Z)-4,4,4-trifluoro-2-(fluoromethyl)but-2-enyl]morpholine (PubChem CID 155323199) has the molecular formula C9H13F4NO and a molecular weight of 227.20 g/mol. Its IUPAC name is 4-[(Z)-4,4,4-trifluoro-2-(fluoromethyl)but-2-enyl]morpholine.
| Compound Name | 4-[(Z)-4,4,4-trifluoro-2-(fluoromethyl)but-2-enyl]morpholine |
|---|---|
| PubChem CID | 155323199 |
| Molecular Formula | C9H13F4NO |
| Molecular Weight | 227.20 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 4-[(Z)-4,4,4-trifluoro-2-(fluoromethyl)but-2-enyl]morpholine |
| SMILES | FC/C(=C\C(F)(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C9H13F4NO/c10-6-8(5-9(11,12)13)7-14-1-3-15-4-2-14/h5H,1-4,6-7H2/b8-5+ |
| InChIKey | OCUREKOFWRTOOK-VMPITWQZSA-N |
| XLogP | 1.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|