2-(2,2,4,4-tetramethylpentylamino)acetic acid

C11H23NO2 — CID 155323369

IUPAC2-(2,2,4,4-tetramethylpentylamino)acetic acid
SMILESCC(C)(C)CC(C)(C)CNCC(=O)O
InChIInChI=1S/C11H23NO2/c1-10(2,3)7-11(4,5)8-12-6-9(13)14/h12H,6-8H2,1-5H3,(H,13,14)
InChIKeyOWIUUOLAFXHYDA-UHFFFAOYSA-N
MW201.31 g/mol
LogP2.12
Rot. Bonds5

About 2-(2,2,4,4-tetramethylpentylamino)acetic acid

2-(2,2,4,4-tetramethylpentylamino)acetic acid (PubChem CID 155323369) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-(2,2,4,4-tetramethylpentylamino)acetic acid.

Molecular Properties

Compound Name2-(2,2,4,4-tetramethylpentylamino)acetic acid
PubChem CID155323369
Molecular FormulaC11H23NO2
Molecular Weight201.31 g/mol
Exact Mass201.17
IUPAC Name2-(2,2,4,4-tetramethylpentylamino)acetic acid
SMILESCC(C)(C)CC(C)(C)CNCC(=O)O
InChIInChI=1S/C11H23NO2/c1-10(2,3)7-11(4,5)8-12-6-9(13)14/h12H,6-8H2,1-5H3,(H,13,14)
InChIKeyOWIUUOLAFXHYDA-UHFFFAOYSA-N
XLogP2.12
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.31
LogP ≤ 52.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(2,2,4,4-tetramethylpentylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2,4,4-tetramethylpentylamino)acetic acid?
The IUPAC name of 2-(2,2,4,4-tetramethylpentylamino)acetic acid (CID 155323369) is 2-(2,2,4,4-tetramethylpentylamino)acetic acid.
What is the SMILES notation for 2-(2,2,4,4-tetramethylpentylamino)acetic acid?
The canonical SMILES for 2-(2,2,4,4-tetramethylpentylamino)acetic acid is CC(C)(C)CC(C)(C)CNCC(=O)O.
What is the InChIKey of 2-(2,2,4,4-tetramethylpentylamino)acetic acid?
The InChIKey is OWIUUOLAFXHYDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-10(2,3)7-11(4,5)8-12-6-9(13)14/h12H,6-8H2,1-5H3,(H,13,14).
What are the key properties of 2-(2,2,4,4-tetramethylpentylamino)acetic acid?
2-(2,2,4,4-tetramethylpentylamino)acetic acid has a molecular weight of 201.31 g/mol, XLogP of 2.12, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2,4,4-tetramethylpentylamino)acetic acid is sourced from PubChem (CID 155323369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).