C19H17ClN2 — CID 155327556
3-N-[(3-chlorophenyl)methyl]-1,4-dimethylidenenaphthalene-2,3-diamine (PubChem CID 155327556) has the molecular formula C19H17ClN2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 3-N-[(3-chlorophenyl)methyl]-1,4-dimethylidenenaphthalene-2,3-diamine.
| Compound Name | 3-N-[(3-chlorophenyl)methyl]-1,4-dimethylidenenaphthalene-2,3-diamine |
|---|---|
| PubChem CID | 155327556 |
| Molecular Formula | C19H17ClN2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 3-N-[(3-chlorophenyl)methyl]-1,4-dimethylidenenaphthalene-2,3-diamine |
| SMILES | C=c1c(N)c(NCc2cccc(Cl)c2)c(=C)c2ccccc12 |
| InChI | InChI=1S/C19H17ClN2/c1-12-16-8-3-4-9-17(16)13(2)19(18(12)21)22-11-14-6-5-7-15(20)10-14/h3-10,22H,1-2,11,21H2 |
| InChIKey | XAMPGXMMDWUWLW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|