C17H20N4OS — CID 155330002
1,3-diamino-1-benzyl-3-[(E)-2-(4-methylphenyl)sulfanylethenyl]urea (PubChem CID 155330002) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 1,3-diamino-1-benzyl-3-[(E)-2-(4-methylphenyl)sulfanylethenyl]urea.
| Compound Name | 1,3-diamino-1-benzyl-3-[(E)-2-(4-methylphenyl)sulfanylethenyl]urea |
|---|---|
| PubChem CID | 155330002 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1,3-diamino-1-benzyl-3-[(E)-2-(4-methylphenyl)sulfanylethenyl]urea |
| SMILES | Cc1ccc(S/C=C/N(N)C(=O)N(N)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H20N4OS/c1-14-7-9-16(10-8-14)23-12-11-20(18)17(22)21(19)13-15-5-3-2-4-6-15/h2-12H,13,18-19H2,1H3/b12-11+ |
| InChIKey | SQUYWLUNHZVTTM-VAWYXSNFSA-N |
| XLogP | 3.23 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|