C23H26ClN5O3 — CID 155335098
1-[[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,3'-cyclobutane]-1'-yl]methyl]-6-chloropyridin-2-one (PubChem CID 155335098) has the molecular formula C23H26ClN5O3 and a molecular weight of 455.95 g/mol. Its IUPAC name is 1-[[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,3'-cyclobutane]-1'-yl]methyl]-6-chloropyridin-2-one.
| Compound Name | 1-[[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,3'-cyclobutane]-1'-yl]methyl]-6-chloropyridin-2-one |
|---|---|
| PubChem CID | 155335098 |
| Molecular Formula | C23H26ClN5O3 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 1-[[(3aR,6R,6aS)-6-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,3'-cyclobutane]-1'-yl]methyl]-6-chloropyridin-2-one |
| SMILES | CC1(C)O[C@H]2[C@H](n3ccc4c(N)ncnc43)CC3(CC(Cn4c(Cl)cccc4=O)C3)[C@H]2O1 |
| InChI | InChI=1S/C23H26ClN5O3/c1-22(2)31-18-15(28-7-6-14-20(25)26-12-27-21(14)28)10-23(19(18)32-22)8-13(9-23)11-29-16(24)4-3-5-17(29)30/h3-7,12-13,15,18-19H,8-11H2,1-2H3,(H2,25,26,27)/t13?,15-,18+,19+,23?/m1/s1 |
| InChIKey | TULORONJYIYHSN-LRHKRZBTSA-N |
| XLogP | 3.39 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|